C45H86NO5+ — CID 129393884
bis[(Z,2S)-1-carboxyicos-11-en-2-yl]-(2-hydroxyethyl)-methylazanium (PubChem CID 129393884) has the molecular formula C45H86NO5+ and a molecular weight of 721.18 g/mol. Its IUPAC name is bis[(Z,2S)-1-carboxyicos-11-en-2-yl]-(2-hydroxyethyl)-methylazanium.
| Compound Name | bis[(Z,2S)-1-carboxyicos-11-en-2-yl]-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 129393884 |
| Molecular Formula | C45H86NO5+ |
| Molecular Weight | 721.18 g/mol |
| Exact Mass | 720.65 |
| IUPAC Name | bis[(Z,2S)-1-carboxyicos-11-en-2-yl]-(2-hydroxyethyl)-methylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[C@@H](CC(=O)O)[N+](C)(CCO)[C@@H](CCCCCCCC/C=C\CCCCCCCC)CC(=O)O |
| InChI | InChI=1S/C45H85NO5/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-42(40-44(48)49)46(3,38-39-47)43(41-45(50)51)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,42-43,47H,4-17,22-41H2,1-3H3,(H-,48,49,50,51)/p+1/b20-18-,21-19-/t42-,43-/m0/s1 |
| InChIKey | STGSHPRXGNWRFM-FLJPJEBUSA-O |
| XLogP | 12.97 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.18 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|