About propanoic acid;(Z)-tetradec-9-en-1-ol
propanoic acid;(Z)-tetradec-9-en-1-ol (PubChem CID 175420248) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is propanoic acid;(Z)-tetradec-9-en-1-ol.
Molecular Properties
| Compound Name | propanoic acid;(Z)-tetradec-9-en-1-ol |
| PubChem CID | 175420248 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | propanoic acid;(Z)-tetradec-9-en-1-ol |
| SMILES | CCC(=O)O.CCCC/C=C\CCCCCCCCO |
| InChI | InChI=1S/C14H28O.C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15;1-2-3(4)5/h5-6,15H,2-4,7-14H2,1H3;2H2,1H3,(H,4,5)/b6-5-; |
| InChIKey | DHNWVIKPPFPKLS-YSMBQZINSA-N |
| XLogP | 4.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;(Z)-tetradec-9-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;(Z)-tetradec-9-en-1-ol?
The IUPAC name of propanoic acid;(Z)-tetradec-9-en-1-ol (CID 175420248) is propanoic acid;(Z)-tetradec-9-en-1-ol.
What is the SMILES notation for propanoic acid;(Z)-tetradec-9-en-1-ol?
The canonical SMILES for propanoic acid;(Z)-tetradec-9-en-1-ol is CCC(=O)O.CCCC/C=C\CCCCCCCCO.
What is the InChIKey of propanoic acid;(Z)-tetradec-9-en-1-ol?
The InChIKey is DHNWVIKPPFPKLS-YSMBQZINSA-N. The full InChI is InChI=1S/C14H28O.C3H6O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15;1-2-3(4)5/h5-6,15H,2-4,7-14H2,1H3;2H2,1H3,(H,4,5)/b6-5-;.
What are the key properties of propanoic acid;(Z)-tetradec-9-en-1-ol?
propanoic acid;(Z)-tetradec-9-en-1-ol has a molecular weight of 286.46 g/mol, XLogP of 4.94, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;(Z)-tetradec-9-en-1-ol is sourced from PubChem (CID 175420248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).