C11H11F3N2O2S — CID 129400184
1-methyl-4-[[(S)-(2-methylfuran-3-yl)sulfinyl]methyl]-5-(trifluoromethyl)pyrazole (PubChem CID 129400184) has the molecular formula C11H11F3N2O2S and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-methyl-4-[[(S)-(2-methylfuran-3-yl)sulfinyl]methyl]-5-(trifluoromethyl)pyrazole.
| Compound Name | 1-methyl-4-[[(S)-(2-methylfuran-3-yl)sulfinyl]methyl]-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 129400184 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1-methyl-4-[[(S)-(2-methylfuran-3-yl)sulfinyl]methyl]-5-(trifluoromethyl)pyrazole |
| SMILES | Cc1occc1[S@@](=O)Cc1cnn(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2S/c1-7-9(3-4-18-7)19(17)6-8-5-15-16(2)10(8)11(12,13)14/h3-5H,6H2,1-2H3/t19-/m0/s1 |
| InChIKey | JXRSHYICEOWFRU-IBGZPJMESA-N |
| XLogP | 2.65 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |