C11H13F3N4O2S — CID 167853350
4-[(1-ethylimidazol-2-yl)sulfonylmethyl]-1-methyl-5-(trifluoromethyl)pyrazole (PubChem CID 167853350) has the molecular formula C11H13F3N4O2S and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-[(1-ethylimidazol-2-yl)sulfonylmethyl]-1-methyl-5-(trifluoromethyl)pyrazole.
| Compound Name | 4-[(1-ethylimidazol-2-yl)sulfonylmethyl]-1-methyl-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 167853350 |
| Molecular Formula | C11H13F3N4O2S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 4-[(1-ethylimidazol-2-yl)sulfonylmethyl]-1-methyl-5-(trifluoromethyl)pyrazole |
| SMILES | CCn1ccnc1S(=O)(=O)Cc1cnn(C)c1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O2S/c1-3-18-5-4-15-10(18)21(19,20)7-8-6-16-17(2)9(8)11(12,13)14/h4-6H,3,7H2,1-2H3 |
| InChIKey | JZOGQCSRQJDVOP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |