C11H14F3N5O2S — CID 166257966
1-ethyl-4-[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methylsulfonylmethyl]triazole (PubChem CID 166257966) has the molecular formula C11H14F3N5O2S and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-ethyl-4-[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methylsulfonylmethyl]triazole.
| Compound Name | 1-ethyl-4-[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methylsulfonylmethyl]triazole |
|---|---|
| PubChem CID | 166257966 |
| Molecular Formula | C11H14F3N5O2S |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-ethyl-4-[[1-methyl-5-(trifluoromethyl)pyrazol-4-yl]methylsulfonylmethyl]triazole |
| SMILES | CCn1cc(CS(=O)(=O)Cc2cnn(C)c2C(F)(F)F)nn1 |
| InChI | InChI=1S/C11H14F3N5O2S/c1-3-19-5-9(16-17-19)7-22(20,21)6-8-4-15-18(2)10(8)11(12,13)14/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | AGOBQNHZLQONCJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |