C16H20N4O2 — CID 129402871
(3R)-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione (PubChem CID 129402871) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3R)-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 129402871 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3R)-1-(imidazo[1,2-a]pyrimidin-2-ylmethyl)-3-methyl-3-(2-methylpropyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)C[C@]1(C)CC(=O)N(Cc2cn3cccnc3n2)C1=O |
| InChI | InChI=1S/C16H20N4O2/c1-11(2)7-16(3)8-13(21)20(14(16)22)10-12-9-19-6-4-5-17-15(19)18-12/h4-6,9,11H,7-8,10H2,1-3H3/t16-/m1/s1 |
| InChIKey | UUYSJENHVUWIDB-MRXNPFEDSA-N |
| XLogP | 2.04 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|