C18H19N5S — CID 129403573
N-[(S)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-2-(1-methylindazol-3-yl)ethanamine (PubChem CID 129403573) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[(S)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-2-(1-methylindazol-3-yl)ethanamine.
| Compound Name | N-[(S)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-2-(1-methylindazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 129403573 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-[(S)-1H-imidazol-2-yl(thiophen-2-yl)methyl]-2-(1-methylindazol-3-yl)ethanamine |
| SMILES | Cn1nc(CCN[C@@H](c2ncc[nH]2)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C18H19N5S/c1-23-15-6-3-2-5-13(15)14(22-23)8-9-19-17(16-7-4-12-24-16)18-20-10-11-21-18/h2-7,10-12,17,19H,8-9H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | DPQQXGPWLHUCGP-QGZVFWFLSA-N |
| XLogP | 3.28 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |