C13H17N3OS2 — CID 129403532
(3S)-3-[[[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]amino]methyl]thiolan-3-ol (PubChem CID 129403532) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is (3S)-3-[[[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]amino]methyl]thiolan-3-ol.
| Compound Name | (3S)-3-[[[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]amino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 129403532 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (3S)-3-[[[(R)-1H-imidazol-2-yl(thiophen-2-yl)methyl]amino]methyl]thiolan-3-ol |
| SMILES | O[C@]1(CN[C@H](c2ncc[nH]2)c2cccs2)CCSC1 |
| InChI | InChI=1S/C13H17N3OS2/c17-13(3-7-18-9-13)8-16-11(10-2-1-6-19-10)12-14-4-5-15-12/h1-2,4-6,11,16-17H,3,7-9H2,(H,14,15)/t11-,13-/m0/s1 |
| InChIKey | BZYSRCYOXYHHHB-AAEUAGOBSA-N |
| XLogP | 2.02 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |