C14H16ClNO2S2 — CID 106099922
3-[[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]methyl]oxolan-3-ol (PubChem CID 106099922) has the molecular formula C14H16ClNO2S2 and a molecular weight of 329.87 g/mol. Its IUPAC name is 3-[[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]methyl]oxolan-3-ol.
| Compound Name | 3-[[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 106099922 |
| Molecular Formula | C14H16ClNO2S2 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 3-[[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]methyl]oxolan-3-ol |
| SMILES | OC1(CNC(c2cccs2)c2ccc(Cl)s2)CCOC1 |
| InChI | InChI=1S/C14H16ClNO2S2/c15-12-4-3-11(20-12)13(10-2-1-7-19-10)16-8-14(17)5-6-18-9-14/h1-4,7,13,16-17H,5-6,8-9H2 |
| InChIKey | ZWAQMNHSPAWGFA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |