C16H16ClN3S — CID 99843227
(1S)-N-[(5-chloro-2-methylphenyl)methyl]-1-(1H-imidazol-2-yl)-1-thiophen-2-ylmethanamine (PubChem CID 99843227) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is (1S)-N-[(5-chloro-2-methylphenyl)methyl]-1-(1H-imidazol-2-yl)-1-thiophen-2-ylmethanamine.
| Compound Name | (1S)-N-[(5-chloro-2-methylphenyl)methyl]-1-(1H-imidazol-2-yl)-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 99843227 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (1S)-N-[(5-chloro-2-methylphenyl)methyl]-1-(1H-imidazol-2-yl)-1-thiophen-2-ylmethanamine |
| SMILES | Cc1ccc(Cl)cc1CN[C@@H](c1ncc[nH]1)c1cccs1 |
| InChI | InChI=1S/C16H16ClN3S/c1-11-4-5-13(17)9-12(11)10-20-15(14-3-2-8-21-14)16-18-6-7-19-16/h2-9,15,20H,10H2,1H3,(H,18,19)/t15-/m1/s1 |
| InChIKey | YQRZABJCJBXTQT-OAHLLOKOSA-N |
| XLogP | 4.31 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |