C20H23N — CID 129406602
(1R,8S)-N-methyl-3-propyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-amine (PubChem CID 129406602) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is (1R,8S)-N-methyl-3-propyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-amine.
| Compound Name | (1R,8S)-N-methyl-3-propyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-amine |
|---|---|
| PubChem CID | 129406602 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (1R,8S)-N-methyl-3-propyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-amine |
| SMILES | CCCc1cccc2c1[C@@]1(NC)CC[C@H]2c2ccccc21 |
| InChI | InChI=1S/C20H23N/c1-3-7-14-8-6-10-17-15-12-13-20(21-2,19(14)17)18-11-5-4-9-16(15)18/h4-6,8-11,15,21H,3,7,12-13H2,1-2H3/t15-,20+/m0/s1 |
| InChIKey | CRVGBRXQLKEZAD-MGPUTAFESA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |