C16H13Se — CID 119078265
CID 119078265 (PubChem CID 119078265) has the molecular formula C16H13Se and a molecular weight of 284.24 g/mol.
| Compound Name | CID 119078265 |
|---|---|
| PubChem CID | 119078265 |
| Molecular Formula | C16H13Se |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | — |
| SMILES | [Se]C12CCC(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C16H13Se/c17-16-10-9-11(12-5-1-3-7-14(12)16)13-6-2-4-8-15(13)16/h1-8,11H,9-10H2 |
| InChIKey | KQNPORDQAQLBLP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|