C8H15NO — CID 129408049
[(3S,4S)-4-cyclopropylpyrrolidin-3-yl]methanol (PubChem CID 129408049) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is [(3S,4S)-4-cyclopropylpyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4S)-4-cyclopropylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 129408049 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | [(3S,4S)-4-cyclopropylpyrrolidin-3-yl]methanol |
| SMILES | OC[C@@H]1CNC[C@H]1C1CC1 |
| InChI | InChI=1S/C8H15NO/c10-5-7-3-9-4-8(7)6-1-2-6/h6-10H,1-5H2/t7-,8-/m0/s1 |
| InChIKey | CJADNGHRHZCOSY-YUMQZZPRSA-N |
| XLogP | 0.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |