C19H23F2NO2 — CID 129408054
(2S)-2-[bis[(4-fluorophenyl)methyl]amino]pentane-1,5-diol (PubChem CID 129408054) has the molecular formula C19H23F2NO2 and a molecular weight of 335.39 g/mol. Its IUPAC name is (2S)-2-[bis[(4-fluorophenyl)methyl]amino]pentane-1,5-diol.
| Compound Name | (2S)-2-[bis[(4-fluorophenyl)methyl]amino]pentane-1,5-diol |
|---|---|
| PubChem CID | 129408054 |
| Molecular Formula | C19H23F2NO2 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (2S)-2-[bis[(4-fluorophenyl)methyl]amino]pentane-1,5-diol |
| SMILES | OCCC[C@@H](CO)N(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23F2NO2/c20-17-7-3-15(4-8-17)12-22(19(14-24)2-1-11-23)13-16-5-9-18(21)10-6-16/h3-10,19,23-24H,1-2,11-14H2/t19-/m0/s1 |
| InChIKey | MAJDARGBTPUXRV-IBGZPJMESA-N |
| XLogP | 3.10 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |