C21H28F2N2 — CID 67734751
6-(4-fluorophenyl)-2-N-[(4-fluorophenyl)methyl]-1-N,2-N-dimethylhexane-1,2-diamine (PubChem CID 67734751) has the molecular formula C21H28F2N2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-N-[(4-fluorophenyl)methyl]-1-N,2-N-dimethylhexane-1,2-diamine.
| Compound Name | 6-(4-fluorophenyl)-2-N-[(4-fluorophenyl)methyl]-1-N,2-N-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 67734751 |
| Molecular Formula | C21H28F2N2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 6-(4-fluorophenyl)-2-N-[(4-fluorophenyl)methyl]-1-N,2-N-dimethylhexane-1,2-diamine |
| SMILES | CNCC(CCCCc1ccc(F)cc1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H28F2N2/c1-24-15-21(25(2)16-18-9-13-20(23)14-10-18)6-4-3-5-17-7-11-19(22)12-8-17/h7-14,21,24H,3-6,15-16H2,1-2H3 |
| InChIKey | SOXILGFFAXMADK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|