C10H18O4 — CID 129408225
methyl 2-[(2R,5R)-5-hydroxyoxan-2-yl]-2-methylpropanoate (PubChem CID 129408225) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 2-[(2R,5R)-5-hydroxyoxan-2-yl]-2-methylpropanoate.
| Compound Name | methyl 2-[(2R,5R)-5-hydroxyoxan-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 129408225 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl 2-[(2R,5R)-5-hydroxyoxan-2-yl]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H]1CC[C@@H](O)CO1 |
| InChI | InChI=1S/C10H18O4/c1-10(2,9(12)13-3)8-5-4-7(11)6-14-8/h7-8,11H,4-6H2,1-3H3/t7-,8-/m1/s1 |
| InChIKey | WBXXFAOFOPOSPH-HTQZYQBOSA-N |
| XLogP | 0.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |