C8H16O2 — CID 129415600
(3R,5R)-5-tert-butyloxolan-3-ol (PubChem CID 129415600) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (3R,5R)-5-tert-butyloxolan-3-ol.
| Compound Name | (3R,5R)-5-tert-butyloxolan-3-ol |
|---|---|
| PubChem CID | 129415600 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (3R,5R)-5-tert-butyloxolan-3-ol |
| SMILES | CC(C)(C)[C@H]1C[C@@H](O)CO1 |
| InChI | InChI=1S/C8H16O2/c1-8(2,3)7-4-6(9)5-10-7/h6-7,9H,4-5H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | ZMSMOSMYEZTYGU-RNFRBKRXSA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |