C18H24N6O4S — CID 129409162
N-[(3S)-1-[2-(2-nitroanilino)pyrimidin-4-yl]piperidin-3-yl]propane-1-sulfonamide (PubChem CID 129409162) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is N-[(3S)-1-[2-(2-nitroanilino)pyrimidin-4-yl]piperidin-3-yl]propane-1-sulfonamide.
| Compound Name | N-[(3S)-1-[2-(2-nitroanilino)pyrimidin-4-yl]piperidin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 129409162 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[(3S)-1-[2-(2-nitroanilino)pyrimidin-4-yl]piperidin-3-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N[C@H]1CCCN(c2ccnc(Nc3ccccc3[N+](=O)[O-])n2)C1 |
| InChI | InChI=1S/C18H24N6O4S/c1-2-12-29(27,28)22-14-6-5-11-23(13-14)17-9-10-19-18(21-17)20-15-7-3-4-8-16(15)24(25)26/h3-4,7-10,14,22H,2,5-6,11-13H2,1H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | HGMACWBCKCPGPF-AWEZNQCLSA-N |
| XLogP | 2.43 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|