C16H15NO2 — CID 129409898
4-[(1E,2S)-1-hydroxyimino-3,4-dihydro-2H-naphthalen-2-yl]phenol (PubChem CID 129409898) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[(1E,2S)-1-hydroxyimino-3,4-dihydro-2H-naphthalen-2-yl]phenol.
| Compound Name | 4-[(1E,2S)-1-hydroxyimino-3,4-dihydro-2H-naphthalen-2-yl]phenol |
|---|---|
| PubChem CID | 129409898 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[(1E,2S)-1-hydroxyimino-3,4-dihydro-2H-naphthalen-2-yl]phenol |
| SMILES | O/N=C1/c2ccccc2CC[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C16H15NO2/c18-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)16(15)17-19/h1-6,8-9,15,18-19H,7,10H2/b17-16-/t15-/m0/s1 |
| InChIKey | XLFDOHWMRWMFHJ-DZHJMQLISA-N |
| XLogP | 3.30 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|