C11H15FN2O — CID 129411560
3-fluoro-N-[(2S,4S)-2-methyloxan-4-yl]pyridin-2-amine (PubChem CID 129411560) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-fluoro-N-[(2S,4S)-2-methyloxan-4-yl]pyridin-2-amine.
| Compound Name | 3-fluoro-N-[(2S,4S)-2-methyloxan-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 129411560 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-fluoro-N-[(2S,4S)-2-methyloxan-4-yl]pyridin-2-amine |
| SMILES | C[C@H]1C[C@@H](Nc2ncccc2F)CCO1 |
| InChI | InChI=1S/C11H15FN2O/c1-8-7-9(4-6-15-8)14-11-10(12)3-2-5-13-11/h2-3,5,8-9H,4,6-7H2,1H3,(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | NRWMCLFLTUTRAO-IUCAKERBSA-N |
| XLogP | 2.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |