C7H11NO2 — CID 129413410
(1S,2S,5R)-2-hydroxy-6-azabicyclo[3.2.1]octan-7-one (PubChem CID 129413410) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (1S,2S,5R)-2-hydroxy-6-azabicyclo[3.2.1]octan-7-one.
| Compound Name | (1S,2S,5R)-2-hydroxy-6-azabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 129413410 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (1S,2S,5R)-2-hydroxy-6-azabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N[C@@H]2CC[C@H](O)[C@@H]1C2 |
| InChI | InChI=1S/C7H11NO2/c9-6-2-1-4-3-5(6)7(10)8-4/h4-6,9H,1-3H2,(H,8,10)/t4-,5+,6+/m1/s1 |
| InChIKey | RWGGGPWVIRCTJG-SRQIZXRXSA-N |
| XLogP | -0.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |