C25H19ClN2O6S2 — CID 129419594
2-[(1R,2S,9S,10R,11S,12S,16S)-9-[5-(2-chlorophenyl)furan-2-yl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 129419594) has the molecular formula C25H19ClN2O6S2 and a molecular weight of 543.02 g/mol. Its IUPAC name is 2-[(1R,2S,9S,10R,11S,12S,16S)-9-[5-(2-chlorophenyl)furan-2-yl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(1R,2S,9S,10R,11S,12S,16S)-9-[5-(2-chlorophenyl)furan-2-yl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 129419594 |
| Molecular Formula | C25H19ClN2O6S2 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 2-[(1R,2S,9S,10R,11S,12S,16S)-9-[5-(2-chlorophenyl)furan-2-yl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H](c2ccc(-c4ccccc4Cl)o2)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C25H19ClN2O6S2/c26-12-4-2-1-3-9(12)13-5-6-14(34-13)19-16-10-7-11(20(16)35-22-21(19)36-25(33)27-22)18-17(10)23(31)28(24(18)32)8-15(29)30/h1-6,10-11,16-20H,7-8H2,(H,27,33)(H,29,30)/t10-,11-,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | AENVTMCWLDRGCO-MMHZAZMHSA-N |
| XLogP | 3.91 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|