C24H33Cl3O13 — CID 129420756
[(2S,3R,4S,5S,6R)-4,5-diacetyloxy-3-chloro-6-[[(2S,3S,4R,5S)-3,4-diacetyloxy-2,5-bis(chloromethyl)oxolan-2-yl]methoxymethyl]oxan-2-yl]methyl acetate (PubChem CID 129420756) has the molecular formula C24H33Cl3O13 and a molecular weight of 635.87 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-3-chloro-6-[[(2S,3S,4R,5S)-3,4-diacetyloxy-2,5-bis(chloromethyl)oxolan-2-yl]methoxymethyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-3-chloro-6-[[(2S,3S,4R,5S)-3,4-diacetyloxy-2,5-bis(chloromethyl)oxolan-2-yl]methoxymethyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129420756 |
| Molecular Formula | C24H33Cl3O13 |
| Molecular Weight | 635.87 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-diacetyloxy-3-chloro-6-[[(2S,3S,4R,5S)-3,4-diacetyloxy-2,5-bis(chloromethyl)oxolan-2-yl]methoxymethyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](COC[C@]2(CCl)O[C@H](CCl)[C@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1Cl |
| InChI | InChI=1S/C24H33Cl3O13/c1-11(28)34-8-17-19(27)22(37-14(4)31)20(35-12(2)29)18(39-17)7-33-10-24(9-26)23(38-15(5)32)21(36-13(3)30)16(6-25)40-24/h16-23H,6-10H2,1-5H3/t16-,17+,18-,19-,20+,21+,22-,23+,24+/m1/s1 |
| InChIKey | LJRXHHBPRPBNCL-KZVZXOIJSA-N |
| XLogP | 1.28 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.87 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|