C30H30N2O10 — CID 129421582
[(2S,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylquinoline-4-carbonyl)amino]oxan-2-yl]methyl acetate (PubChem CID 129421582) has the molecular formula C30H30N2O10 and a molecular weight of 578.57 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylquinoline-4-carbonyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylquinoline-4-carbonyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 129421582 |
| Molecular Formula | C30H30N2O10 |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,4,6-triacetyloxy-5-[(2-phenylquinoline-4-carbonyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](OC(C)=O)[C@H](NC(=O)c2cc(-c3ccccc3)nc3ccccc23)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H30N2O10/c1-16(33)38-15-25-27(39-17(2)34)28(40-18(3)35)26(30(42-25)41-19(4)36)32-29(37)22-14-24(20-10-6-5-7-11-20)31-23-13-9-8-12-21(22)23/h5-14,25-28,30H,15H2,1-4H3,(H,32,37)/t25-,26+,27-,28-,30-/m0/s1 |
| InChIKey | VVMNWCWAUDNQKP-WHIZXEAUSA-N |
| XLogP | 2.71 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|