C21H25N3O13 — CID 46929700
[(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(6-methyl-5-nitro-4-oxo-1H-pyridine-3-carbonyl)amino]oxan-2-yl]methyl acetate (PubChem CID 46929700) has the molecular formula C21H25N3O13 and a molecular weight of 527.44 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(6-methyl-5-nitro-4-oxo-1H-pyridine-3-carbonyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(6-methyl-5-nitro-4-oxo-1H-pyridine-3-carbonyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46929700 |
| Molecular Formula | C21H25N3O13 |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,6-triacetyloxy-5-[(6-methyl-5-nitro-4-oxo-1H-pyridine-3-carbonyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](NC(=O)c2c[nH]c(C)c([N+](=O)[O-])c2=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H25N3O13/c1-8-16(24(31)32)17(29)13(6-22-8)20(30)23-15-19(35-11(4)27)18(34-10(3)26)14(7-33-9(2)25)37-21(15)36-12(5)28/h6,14-15,18-19,21H,7H2,1-5H3,(H,22,29)(H,23,30)/t14-,15-,18+,19-,21-/m1/s1 |
| InChIKey | KGVTWPKUIMPGGF-VDPHBXFDSA-N |
| XLogP | -0.60 |
| TPSA | 219.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|