C31H31N2O12P — CID 157376850
[(3S,4R)-3,4-diacetyloxy-5-[(2-diphenylphosphorylbenzoyl)amino]-6-nitrooxyoxan-2-yl]methyl acetate (PubChem CID 157376850) has the molecular formula C31H31N2O12P and a molecular weight of 654.57 g/mol. Its IUPAC name is [(3S,4R)-3,4-diacetyloxy-5-[(2-diphenylphosphorylbenzoyl)amino]-6-nitrooxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R)-3,4-diacetyloxy-5-[(2-diphenylphosphorylbenzoyl)amino]-6-nitrooxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 157376850 |
| Molecular Formula | C31H31N2O12P |
| Molecular Weight | 654.57 g/mol |
| Exact Mass | 654.16 |
| IUPAC Name | [(3S,4R)-3,4-diacetyloxy-5-[(2-diphenylphosphorylbenzoyl)amino]-6-nitrooxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O[N+](=O)[O-])C(NC(=O)c2ccccc2P(=O)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H31N2O12P/c1-19(34)41-18-25-28(42-20(2)35)29(43-21(3)36)27(31(44-25)45-33(38)39)32-30(37)24-16-10-11-17-26(24)46(40,22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-17,25,27-29,31H,18H2,1-3H3,(H,32,37)/t25?,27?,28-,29-,31?/m1/s1 |
| InChIKey | SAPPMTGNXDTQPL-FEOUHADCSA-N |
| XLogP | 1.78 |
| TPSA | 186.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|