C29H32NO6P — CID 88897747
[(3S,4S)-5-[(2-diphenylphosphorylbenzoyl)amino]-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate (PubChem CID 88897747) has the molecular formula C29H32NO6P and a molecular weight of 521.55 g/mol. Its IUPAC name is [(3S,4S)-5-[(2-diphenylphosphorylbenzoyl)amino]-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S)-5-[(2-diphenylphosphorylbenzoyl)amino]-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 88897747 |
| Molecular Formula | C29H32NO6P |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(3S,4S)-5-[(2-diphenylphosphorylbenzoyl)amino]-6-hydroxy-3,4-dimethyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)C(NC(=O)c2ccccc2P(=O)(c2ccccc2)c2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H32NO6P/c1-19-20(2)27(29(33)36-25(19)18-35-21(3)31)30-28(32)24-16-10-11-17-26(24)37(34,22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-17,19-20,25,27,29,33H,18H2,1-3H3,(H,30,32)/t19-,20-,25?,27?,29?/m0/s1 |
| InChIKey | AMRIXDLOHUBHDX-QPGTVXLGSA-N |
| XLogP | 2.98 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|