C18H25NO5 — CID 118053675
[(3S,4S)-6-hydroxy-3,4-dimethyl-5-(phenacylamino)oxan-2-yl]methyl acetate (PubChem CID 118053675) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3S,4S)-6-hydroxy-3,4-dimethyl-5-(phenacylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(3S,4S)-6-hydroxy-3,4-dimethyl-5-(phenacylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 118053675 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3S,4S)-6-hydroxy-3,4-dimethyl-5-(phenacylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O)C(NCC(=O)c2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C18H25NO5/c1-11-12(2)17(18(22)24-16(11)10-23-13(3)20)19-9-15(21)14-7-5-4-6-8-14/h4-8,11-12,16-19,22H,9-10H2,1-3H3/t11-,12-,16?,17?,18?/m0/s1 |
| InChIKey | JDWNUKUWGNHFLO-BQAJHIRISA-N |
| XLogP | 1.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |