C25H26NO7P — CID 59064632
2-diphenylphosphoryl-N-[(3R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide (PubChem CID 59064632) has the molecular formula C25H26NO7P and a molecular weight of 483.46 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N-[(3R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide.
| Compound Name | 2-diphenylphosphoryl-N-[(3R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
|---|---|
| PubChem CID | 59064632 |
| Molecular Formula | C25H26NO7P |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-diphenylphosphoryl-N-[(3R,5R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]benzamide |
| SMILES | O=C(N[C@H]1C(O)OC(CO)[C@H](O)C1O)c1ccccc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26NO7P/c27-15-19-22(28)23(29)21(25(31)33-19)26-24(30)18-13-7-8-14-20(18)34(32,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,19,21-23,25,27-29,31H,15H2,(H,26,30)/t19?,21-,22+,23?,25?/m1/s1 |
| InChIKey | PKJCTEYAPLJKIB-VAVSBIDJSA-N |
| XLogP | -0.14 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|