C19H28N2O3 — CID 129426905
N-[(1R,2R)-2-methylcyclohexyl]-2-[4-[(3S)-oxolan-3-yl]oxyanilino]acetamide (PubChem CID 129426905) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-[4-[(3S)-oxolan-3-yl]oxyanilino]acetamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[4-[(3S)-oxolan-3-yl]oxyanilino]acetamide |
|---|---|
| PubChem CID | 129426905 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[4-[(3S)-oxolan-3-yl]oxyanilino]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CNc1ccc(O[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-14-4-2-3-5-18(14)21-19(22)12-20-15-6-8-16(9-7-15)24-17-10-11-23-13-17/h6-9,14,17-18,20H,2-5,10-13H2,1H3,(H,21,22)/t14-,17+,18-/m1/s1 |
| InChIKey | JNDVKFAVKQSKEF-FHLIZLRMSA-N |
| XLogP | 2.96 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|