C20H28N2O3 — CID 129432640
(2R,4R)-1-acetyl-N-[(5R)-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-yl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 129432640) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2R,4R)-1-acetyl-N-[(5R)-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-yl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-acetyl-N-[(5R)-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-yl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129432640 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | (2R,4R)-1-acetyl-N-[(5R)-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-yl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1C[C@H](O)C[C@@H]1C(=O)N[C@@H]1CC(C)(C)CCc2ccccc21 |
| InChI | InChI=1S/C20H28N2O3/c1-13(23)22-12-15(24)10-18(22)19(25)21-17-11-20(2,3)9-8-14-6-4-5-7-16(14)17/h4-7,15,17-18,24H,8-12H2,1-3H3,(H,21,25)/t15-,17-,18-/m1/s1 |
| InChIKey | GAMSGOYFTQXSGX-KBAYOESNSA-N |
| XLogP | 2.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |