C31H44N4O5 — CID 129435398
(1S,2R,5S,6S,7R)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-methoxyphenyl)-2-N-[(1R,2S)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435398) has the molecular formula C31H44N4O5 and a molecular weight of 552.72 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-methoxyphenyl)-2-N-[(1R,2S)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-methoxyphenyl)-2-N-[(1R,2S)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435398 |
| Molecular Formula | C31H44N4O5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | (1S,2R,5S,6S,7R)-3-[2-[butyl(methyl)amino]ethyl]-6-N-(3-methoxyphenyl)-2-N-[(1R,2S)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCCN(C)CCN1C(=O)[C@H]2[C@H](C(=O)Nc3cccc(OC)c3)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C31H44N4O5/c1-5-6-16-34(3)17-18-35-27(29(37)33-23-13-8-7-10-20(23)2)31-15-14-24(40-31)25(26(31)30(35)38)28(36)32-21-11-9-12-22(19-21)39-4/h9,11-12,14-15,19-20,23-27H,5-8,10,13,16-18H2,1-4H3,(H,32,36)(H,33,37)/t20-,23+,24+,25+,26+,27-,31-/m0/s1 |
| InChIKey | FEGXOTHIJLNQEW-IIFMPASPSA-N |
| XLogP | 3.21 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|