C32H46N4O5 — CID 129436415
(1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436415) has the molecular formula C32H46N4O5 and a molecular weight of 566.74 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436415 |
| Molecular Formula | C32H46N4O5 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | (1S,2R,5R,6S,7S)-3-[2-[butyl(methyl)amino]ethyl]-2-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-6-N-(4-methoxyphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCCCN(C)CCN1C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(OC)cc3)[C@@H]3C=C[C@@]2(O3)[C@@H]1C(=O)N[C@@H]1CCC[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C32H46N4O5/c1-6-7-17-35(4)18-19-36-28(30(38)34-24-10-8-9-20(2)21(24)3)32-16-15-25(41-32)26(27(32)31(36)39)29(37)33-22-11-13-23(40-5)14-12-22/h11-16,20-21,24-28H,6-10,17-19H2,1-5H3,(H,33,37)(H,34,38)/t20-,21-,24-,25+,26-,27+,28+,32+/m1/s1 |
| InChIKey | OPRDWAOIGABHQO-UMNIRDISSA-N |
| XLogP | 3.46 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|