C18H15NO2S — CID 129438079
(2,3-dihydrothiochromen-4-ylideneamino) (Z)-3-phenylprop-2-enoate (PubChem CID 129438079) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2,3-dihydrothiochromen-4-ylideneamino) (Z)-3-phenylprop-2-enoate.
| Compound Name | (2,3-dihydrothiochromen-4-ylideneamino) (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 129438079 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (2,3-dihydrothiochromen-4-ylideneamino) (Z)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C\c1ccccc1)ON=C1CCSc2ccccc21 |
| InChI | InChI=1S/C18H15NO2S/c20-18(11-10-14-6-2-1-3-7-14)21-19-16-12-13-22-17-9-5-4-8-15(16)17/h1-11H,12-13H2/b11-10-,19-16? |
| InChIKey | DHFOPLHRTRFZCI-OARMNENWSA-N |
| XLogP | 4.14 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|