C16H20N2O2 — CID 129439556
N-[1-[(1R,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]ethylideneamino]furan-2-carboxamide (PubChem CID 129439556) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-[1-[(1R,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | N-[1-[(1R,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 129439556 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-[1-[(1R,2R,4R)-3,3-dimethyl-2-bicyclo[2.2.1]hept-5-enyl]ethylideneamino]furan-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccco1)[C@@H]1[C@H]2C=C[C@@H](C2)C1(C)C |
| InChI | InChI=1S/C16H20N2O2/c1-10(17-18-15(19)13-5-4-8-20-13)14-11-6-7-12(9-11)16(14,2)3/h4-8,11-12,14H,9H2,1-3H3,(H,18,19)/t11-,12-,14+/m0/s1 |
| InChIKey | MXNSHUQATDRIAE-SGMGOOAPSA-N |
| XLogP | 3.23 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|