C14H20N2O5 — CID 129440376
(1R,2R,3R,4R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 129440376) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 129440376 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (1R,2R,3R,4R)-3-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NNC(=O)[C@H]1[C@H](C(=O)O)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H20N2O5/c1-14(2,3)21-13(20)16-15-11(17)9-7-4-5-8(6-7)10(9)12(18)19/h4-5,7-10H,6H2,1-3H3,(H,15,17)(H,16,20)(H,18,19)/t7-,8-,9+,10+/m0/s1 |
| InChIKey | SDLHZEZXMRZGRU-AXTSPUMRSA-N |
| XLogP | 1.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|