C14H16Cl2N2O4 — CID 98120736
(1R,2S,3R,4R)-3-[[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 98120736) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 98120736 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[[(1S)-2,2-dichloro-1-methylcyclopropanecarbonyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C[C@@]1(C(=O)NNC(=O)[C@H]2[C@@H](C(=O)O)[C@H]3C=C[C@H]2C3)CC1(Cl)Cl |
| InChI | InChI=1S/C14H16Cl2N2O4/c1-13(5-14(13,15)16)12(22)18-17-10(19)8-6-2-3-7(4-6)9(8)11(20)21/h2-3,6-9H,4-5H2,1H3,(H,17,19)(H,18,22)(H,20,21)/t6-,7-,8+,9-,13-/m0/s1 |
| InChIKey | ZBSQHCMLPOZMBH-IHDRBEERSA-N |
| XLogP | 1.24 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|