C27H19FN4O5S — CID 129442359
(5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 129442359) has the molecular formula C27H19FN4O5S and a molecular weight of 530.54 g/mol. Its IUPAC name is (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 129442359 |
| Molecular Formula | C27H19FN4O5S |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-N-phenyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccc(F)cc2)n2c(sc(=Cc3cccc([N+](=O)[O-])c3O)c2=O)=N1 |
| InChI | InChI=1S/C27H19FN4O5S/c1-15-22(25(34)30-19-7-3-2-4-8-19)23(16-10-12-18(28)13-11-16)31-26(35)21(38-27(31)29-15)14-17-6-5-9-20(24(17)33)32(36)37/h2-14,23,33H,1H3,(H,30,34)/t23-/m1/s1 |
| InChIKey | GKLYNLVVJAWSBZ-HSZRJFAPSA-N |
| XLogP | 3.63 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|