C23H18FN3O6S — CID 129443749
ethyl (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 129443749) has the molecular formula C23H18FN3O6S and a molecular weight of 483.48 g/mol. Its IUPAC name is ethyl (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 129443749 |
| Molecular Formula | C23H18FN3O6S |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | ethyl (5R)-5-(4-fluorophenyl)-2-[(2-hydroxy-3-nitrophenyl)methylidene]-7-methyl-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N=c2sc(=Cc3cccc([N+](=O)[O-])c3O)c(=O)n2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FN3O6S/c1-3-33-22(30)18-12(2)25-23-26(19(18)13-7-9-15(24)10-8-13)21(29)17(34-23)11-14-5-4-6-16(20(14)28)27(31)32/h4-11,19,28H,3H2,1-2H3/t19-/m1/s1 |
| InChIKey | PLYYGKSYFRICHF-LJQANCHMSA-N |
| XLogP | 2.55 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|