C31H41IO6 — CID 129448183
[(3S,5S,8S,9R,10S,13R,14R,16S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-(3-iodophenyl)acetate (PubChem CID 129448183) has the molecular formula C31H41IO6 and a molecular weight of 636.57 g/mol. Its IUPAC name is [(3S,5S,8S,9R,10S,13R,14R,16S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-(3-iodophenyl)acetate.
| Compound Name | [(3S,5S,8S,9R,10S,13R,14R,16S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-(3-iodophenyl)acetate |
|---|---|
| PubChem CID | 129448183 |
| Molecular Formula | C31H41IO6 |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | [(3S,5S,8S,9R,10S,13R,14R,16S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-yl] 2-(3-iodophenyl)acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]2CC[C@]2(C)[C@@H]3C[C@H](OC(=O)Cc3cccc(I)c3)[C@@]2(O)C(C)=O)C1 |
| InChI | InChI=1S/C31H41IO6/c1-18(33)31(36)27(38-28(35)15-20-6-5-7-22(32)14-20)17-26-24-9-8-21-16-23(37-19(2)34)10-12-29(21,3)25(24)11-13-30(26,31)4/h5-7,14,21,23-27,36H,8-13,15-17H2,1-4H3/t21-,23-,24-,25+,26+,27-,29-,30+,31-/m0/s1 |
| InChIKey | QOIJGUZBBFUJSQ-UDOQUYCDSA-N |
| XLogP | 5.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|