C31H41IO6 — CID 99570974
[(3S,5R,7R,8R,9S,10S,13S,14S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] 2-(4-iodophenyl)acetate (PubChem CID 99570974) has the molecular formula C31H41IO6 and a molecular weight of 636.57 g/mol. Its IUPAC name is [(3S,5R,7R,8R,9S,10S,13S,14S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] 2-(4-iodophenyl)acetate.
| Compound Name | [(3S,5R,7R,8R,9S,10S,13S,14S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] 2-(4-iodophenyl)acetate |
|---|---|
| PubChem CID | 99570974 |
| Molecular Formula | C31H41IO6 |
| Molecular Weight | 636.57 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | [(3S,5R,7R,8R,9S,10S,13S,14S,17R)-17-acetyl-3-acetyloxy-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-7-yl] 2-(4-iodophenyl)acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](C1)C[C@@H](OC(=O)Cc1ccc(I)cc1)[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(O)C(C)=O |
| InChI | InChI=1S/C31H41IO6/c1-18(33)31(36)14-11-25-28-24(10-13-30(25,31)4)29(3)12-9-23(37-19(2)34)16-21(29)17-26(28)38-27(35)15-20-5-7-22(32)8-6-20/h5-8,21,23-26,28,36H,9-17H2,1-4H3/t21-,23+,24+,25+,26-,28-,29+,30+,31+/m1/s1 |
| InChIKey | RDEFJHHSORNCMD-SBUADMJJSA-N |
| XLogP | 5.65 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|