C26H37NO14 — CID 129448262
tert-butyl (1S,5R,6R)-4-methyl-6-nitro-5-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxycyclohex-3-ene-1-carboxylate (PubChem CID 129448262) has the molecular formula C26H37NO14 and a molecular weight of 587.58 g/mol. Its IUPAC name is tert-butyl (1S,5R,6R)-4-methyl-6-nitro-5-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxycyclohex-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1S,5R,6R)-4-methyl-6-nitro-5-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 129448262 |
| Molecular Formula | C26H37NO14 |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | tert-butyl (1S,5R,6R)-4-methyl-6-nitro-5-[(2S,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxycyclohex-3-ene-1-carboxylate |
| SMILES | CC(=O)OC[C@@H]1O[C@H](O[C@@H]2C(C)=CC[C@H](C(=O)OC(C)(C)C)[C@H]2[N+](=O)[O-])[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H37NO14/c1-12-9-10-17(24(32)41-26(6,7)8)19(27(33)34)20(12)40-25-23(38-16(5)31)22(37-15(4)30)21(36-14(3)29)18(39-25)11-35-13(2)28/h9,17-23,25H,10-11H2,1-8H3/t17-,18-,19+,20+,21-,22+,23-,25+/m0/s1 |
| InChIKey | IWIRVEKMPPWBIM-SITHFPPRSA-N |
| XLogP | 1.41 |
| TPSA | 193.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|