C18H19ClN4S — CID 129449386
3-(2-chlorophenyl)-4-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 129449386) has the molecular formula C18H19ClN4S and a molecular weight of 358.90 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(2-chlorophenyl)-4-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 129449386 |
| Molecular Formula | C18H19ClN4S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-(2-chlorophenyl)-4-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CC1(C)[C@H]2CC=C(C=Nn3c(-c4ccccc4Cl)n[nH]c3=S)[C@H]1C2 |
| InChI | InChI=1S/C18H19ClN4S/c1-18(2)12-8-7-11(14(18)9-12)10-20-23-16(21-22-17(23)24)13-5-3-4-6-15(13)19/h3-7,10,12,14H,8-9H2,1-2H3,(H,22,24)/t12-,14+/m0/s1 |
| InChIKey | OGOGUNCUNDDLJR-GXTWGEPZSA-N |
| XLogP | 5.09 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|