C19H20F2N4OS — CID 11937707
3-[4-(difluoromethoxy)phenyl]-4-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 11937707) has the molecular formula C19H20F2N4OS and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 11937707 |
| Molecular Formula | C19H20F2N4OS |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-4-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\n3c(-c4ccc(OC(F)F)cc4)n[nH]c3=S)[C@@H]1C2 |
| InChI | InChI=1S/C19H20F2N4OS/c1-19(2)13-6-3-12(15(19)9-13)10-22-25-16(23-24-18(25)27)11-4-7-14(8-5-11)26-17(20)21/h3-5,7-8,10,13,15,17H,6,9H2,1-2H3,(H,24,27)/b22-10-/t13-,15-/m0/s1 |
| InChIKey | DJOCRULSOVSQHK-MHQBHHHDSA-N |
| XLogP | 5.04 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|