C11H16N4O2 — CID 129452508
tert-butyl 6,7-dihydro-5H-pteridine-8-carboxylate (PubChem CID 129452508) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is tert-butyl 6,7-dihydro-5H-pteridine-8-carboxylate.
| Compound Name | tert-butyl 6,7-dihydro-5H-pteridine-8-carboxylate |
|---|---|
| PubChem CID | 129452508 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | tert-butyl 6,7-dihydro-5H-pteridine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCNc2cncnc21 |
| InChI | InChI=1S/C11H16N4O2/c1-11(2,3)17-10(16)15-5-4-13-8-6-12-7-14-9(8)15/h6-7,13H,4-5H2,1-3H3 |
| InChIKey | YSJCBFKMWKELJK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |