C31H36N2O5 — CID 129455858
1-[(3S,3aS,7aR)-1-benzyl-3-(3,4-dimethoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 129455858) has the molecular formula C31H36N2O5 and a molecular weight of 516.64 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-1-benzyl-3-(3,4-dimethoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(3S,3aS,7aR)-1-benzyl-3-(3,4-dimethoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 129455858 |
| Molecular Formula | C31H36N2O5 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 1-[(3S,3aS,7aR)-1-benzyl-3-(3,4-dimethoxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccc([C@H]2CN(Cc3ccccc3)[C@@H]3CCN(C(=O)COc4ccccc4OC)C[C@H]23)cc1OC |
| InChI | InChI=1S/C31H36N2O5/c1-35-27-11-7-8-12-29(27)38-21-31(34)32-16-15-26-25(20-32)24(19-33(26)18-22-9-5-4-6-10-22)23-13-14-28(36-2)30(17-23)37-3/h4-14,17,24-26H,15-16,18-21H2,1-3H3/t24-,25-,26-/m1/s1 |
| InChIKey | JSPTXXAEQKCRRH-TWJOJJKGSA-N |
| XLogP | 4.61 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |