C23H26F2N2O2 — CID 155984729
1-[(3S,3aS,7aR)-1-benzyl-3-(2,4-difluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone (PubChem CID 155984729) has the molecular formula C23H26F2N2O2 and a molecular weight of 400.47 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-1-benzyl-3-(2,4-difluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3S,3aS,7aR)-1-benzyl-3-(2,4-difluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 155984729 |
| Molecular Formula | C23H26F2N2O2 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1-[(3S,3aS,7aR)-1-benzyl-3-(2,4-difluorophenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@@H]2[C@H](C1)[C@@H](c1ccc(F)cc1F)CN2Cc1ccccc1 |
| InChI | InChI=1S/C23H26F2N2O2/c1-29-15-23(28)26-10-9-22-20(14-26)19(18-8-7-17(24)11-21(18)25)13-27(22)12-16-5-3-2-4-6-16/h2-8,11,19-20,22H,9-10,12-15H2,1H3/t19-,20-,22-/m1/s1 |
| InChIKey | HQQBXDYZTJLLMZ-KCZVDYSFSA-N |
| XLogP | 3.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |