C26H33ClN2O3 — CID 155984746
1-[(3S,3aS,7aR)-1-[(3-chlorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone (PubChem CID 155984746) has the molecular formula C26H33ClN2O3 and a molecular weight of 457.01 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-1-[(3-chlorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3S,3aS,7aR)-1-[(3-chlorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 155984746 |
| Molecular Formula | C26H33ClN2O3 |
| Molecular Weight | 457.01 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-[(3S,3aS,7aR)-1-[(3-chlorophenyl)methyl]-3-(4-propan-2-yloxyphenyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@@H]2[C@H](C1)[C@@H](c1ccc(OC(C)C)cc1)CN2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H33ClN2O3/c1-18(2)32-22-9-7-20(8-10-22)23-15-29(14-19-5-4-6-21(27)13-19)25-11-12-28(16-24(23)25)26(30)17-31-3/h4-10,13,18,23-25H,11-12,14-17H2,1-3H3/t23-,24-,25-/m1/s1 |
| InChIKey | ASLSZRKNSTWVRU-UBFVSLLYSA-N |
| XLogP | 4.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.01 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |