C24H28F2N2O3 — CID 155984736
1-[(3S,3aS,7aR)-3-(2,4-difluorophenyl)-1-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone (PubChem CID 155984736) has the molecular formula C24H28F2N2O3 and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-[(3S,3aS,7aR)-3-(2,4-difluorophenyl)-1-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone.
| Compound Name | 1-[(3S,3aS,7aR)-3-(2,4-difluorophenyl)-1-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 155984736 |
| Molecular Formula | C24H28F2N2O3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[(3S,3aS,7aR)-3-(2,4-difluorophenyl)-1-[(4-methoxyphenyl)methyl]-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CC[C@@H]2[C@H](C1)[C@@H](c1ccc(F)cc1F)CN2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28F2N2O3/c1-30-15-24(29)27-10-9-23-21(14-27)20(19-8-5-17(25)11-22(19)26)13-28(23)12-16-3-6-18(31-2)7-4-16/h3-8,11,20-21,23H,9-10,12-15H2,1-2H3/t20-,21-,23-/m1/s1 |
| InChIKey | OGKRLYNUBDRNHD-MQSCRBSSSA-N |
| XLogP | 3.44 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |