C24H33N5O3 — CID 129456351
1-[3-[4-[[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 129456351) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-[3-[4-[[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129456351 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 1-[3-[4-[[[(3R)-3-hydroxy-1-pyrazin-2-ylpiperidin-3-yl]methylamino]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCOc1ccc(CNC[C@]2(O)CCCN(c3cnccn3)C2)cc1 |
| InChI | InChI=1S/C24H33N5O3/c30-23-4-1-12-28(23)14-3-15-32-21-7-5-20(6-8-21)16-26-18-24(31)9-2-13-29(19-24)22-17-25-10-11-27-22/h5-8,10-11,17,26,31H,1-4,9,12-16,18-19H2/t24-/m1/s1 |
| InChIKey | LOHUWLOHJXTQLO-XMMPIXPASA-N |
| XLogP | 1.99 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|